![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Audio/ | 2025-01-08 13:36 | - | |
| Beyer headsets/ | 2025-03-24 19:08 | - | |
| Blanks/ | 2023-08-03 03:40 | - | |
| Calrec IP/ | 2023-08-03 03:40 | - | |
| Cobalt/ | 2024-07-21 10:43 | - | |
| Daily EIC/ | 2024-07-07 01:51 | - | |
| EVS/ | 2024-11-19 14:42 | - | |
| Evertz/ | 2025-04-03 10:43 | - | |
| Grass Valley/ | 2025-06-15 12:29 | - | |
| HDR/ | 2023-08-03 03:40 | - | |
| INFO - IP/ | 2024-12-26 00:14 | - | |
| IP/ | 2024-12-26 00:15 | - | |
| ITU-R BT.2100/ | 2024-12-26 00:15 | - | |
| Info - Audio/ | 2024-12-26 00:15 | - | |
| Info - RF/ | 2024-12-26 00:15 | - | |
| Info - Video/ | 2024-12-26 00:17 | - | |
| Lip Sync/ | 2024-12-26 00:17 | - | |
| Marshall cameras/ | 2024-12-26 00:17 | - | |
| Partner Quick Refs/ | 2024-12-26 00:17 | - | |
| Pesa/ | 2024-12-26 00:17 | - | |
| PinOuts/ | 2024-12-26 00:18 | - | |
| Protocols/ | 2025-05-20 19:57 | - | |
| RF/ | 2025-01-08 13:36 | - | |
| RTS/ | 2025-06-15 12:29 | - | |
| Ross/ | 2024-08-09 00:24 | - | |
| Sony/ | 2025-04-08 02:08 | - | |
| Tektronix/ | 2024-06-20 16:51 | - | |
| Trailer Wiring/ | 2024-12-07 10:25 | - | |
| Utah/ | 2024-11-23 01:13 | - | |
| Video/ | 2025-01-08 13:36 | - | |
| Video delay/ | 2023-09-14 16:30 | - | |
| IGMP snooping.jpeg | 2020-12-28 20:13 | 6.7K | |
| ADC - PPP Normal Switches.pdf | 2012-03-19 13:27 | 9.7K | |
| Tilta pin out M_Rs.png | 2019-10-10 17:47 | 12K | |
| Houston wire chart of power cable size and ratings.pdf | 2014-08-04 21:24 | 14K | |
| What is the difference between RSTP and STP.doc | 2010-07-12 04:00 | 26K | |
| Neutrik triax NBB75DFI.pdf | 2010-09-22 16:52 | 41K | |
| Multicam6_keyboard_labels.pdf | 2005-12-27 19:10 | 51K | |
| K2 codec support.pdf | 2018-01-31 12:13 | 54K | |
| LDK100 audio channel mapping.png | 2021-05-26 09:01 | 82K | |
| Fujinon Serial to analog change Serial 1A to 2Z.pdf | 2018-09-04 21:07 | 88K | |
| snell and wilcox testchart.pdf | 2014-02-22 01:32 | 92K | |
| SPG700 BG 7 .jpeg | 2019-02-17 03:20 | 93K | |
| 2014-05-Recommendations-for-Large-Dante-Networks.pdf | 2017-09-14 17:38 | 103K | |
| XAVC_Profiles_and_OperatingPoints_110.pdf | 2016-07-10 05:01 | 104K | |
| EDXE TEST TONES.pdf | 2019-03-21 13:52 | 108K | |
| SMPTE 12M eATC.pdf | 2017-10-04 12:10 | 124K | |
| eATC.pdf | 2017-10-14 20:48 | 124K | |
| Panasonic_PTZ-Camera_Angle-of-view_Size_Calculator_E.xlsx | 2023-06-26 15:35 | 168K | |
| howdoesbasicrefrigerationcyc.pdf | 2016-09-09 03:04 | 174K | |
| Hitachi CCU 4000 outputs.png | 2022-03-29 22:06 | 177K | |
| Calrec IP.pdf | 2014-02-21 22:21 | 270K | |
| 5601ACO2 backplane.png | 2022-06-03 16:32 | 275K | |
| ntp_cheat_sheet.pdf | 2019-09-18 18:16 | 307K | |
| DPlus_TrueHD_whitepaper.pdf | 2006-05-04 15:05 | 317K | |
| AUDIO PADS.pdf | 2014-11-22 03:16 | 486K | |
| ki pro file creation setup for playback (field).pdf | 2016-09-07 23:24 | 612K | |
| Centrio Hybrid Multiviewer not booting.pdf | 2018-02-19 03:38 | 650K | |
| 540150 G.pdf | 2016-08-07 14:48 | 1.4M | |
| amira-multicam-white-paper-data.pdf | 2021-07-26 12:36 | 1.4M | |
| Leni Lightwave Fiber Guide.pdf | 2014-11-22 03:13 | 2.9M | |
| Calrec-IP-Primer-2022.pdf | 2022-03-26 14:19 | 3.1M | |
| Color Correction Book .pdf | 2014-11-22 03:07 | 3.6M | |
| Lemo HDTV_en.pdf | 2015-06-07 14:57 | 4.3M | |
| product-guide---section-xlr.pdf | 2020-03-01 17:35 | 7.0M | |
| Lawo_VSM_EN w.pdf | 2024-11-13 18:43 | 8.5M | |
| canare_catalog12_all_web.pdf | 2016-05-22 20:12 | 13M | |
| BBC Television French - English Techncial Dictionary.pdf | 2025-06-11 11:04 | 36M | |